C16H13N3O4 — CID 108843993
2-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enoyl]amino]acetic acid (PubChem CID 108843993) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 108843993 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enoyl]amino]acetic acid |
| SMILES | N#C/C(=C/Nc1cccc2c(O)cccc12)C(=O)NCC(=O)O |
| InChI | InChI=1S/C16H13N3O4/c17-7-10(16(23)19-9-15(21)22)8-18-13-5-1-4-12-11(13)3-2-6-14(12)20/h1-6,8,18,20H,9H2,(H,19,23)(H,21,22)/b10-8- |
| InChIKey | CPXSQHAQBPNQBI-NTMALXAHSA-N |
| XLogP | 1.57 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|