C22H49FO3Si2 — CID 10884632
3-[ditert-butyl(fluoro)silyl]oxy-5-tri(propan-2-yl)silyloxypentan-1-ol (PubChem CID 10884632) has the molecular formula C22H49FO3Si2 and a molecular weight of 436.80 g/mol. Its IUPAC name is 3-[ditert-butyl(fluoro)silyl]oxy-5-tri(propan-2-yl)silyloxypentan-1-ol.
| Compound Name | 3-[ditert-butyl(fluoro)silyl]oxy-5-tri(propan-2-yl)silyloxypentan-1-ol |
|---|---|
| PubChem CID | 10884632 |
| Molecular Formula | C22H49FO3Si2 |
| Molecular Weight | 436.80 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | 3-[ditert-butyl(fluoro)silyl]oxy-5-tri(propan-2-yl)silyloxypentan-1-ol |
| SMILES | CC(C)[Si](OCCC(CCO)O[Si](F)(C(C)(C)C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H49FO3Si2/c1-17(2)27(18(3)4,19(5)6)25-16-14-20(13-15-24)26-28(23,21(7,8)9)22(10,11)12/h17-20,24H,13-16H2,1-12H3 |
| InChIKey | NEOYIIRAMQSWFD-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.80 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|