C18H39F3O3Si2 — CID 134943548
(2S,3R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(trifluoromethyl)pentan-1-ol (PubChem CID 134943548) has the molecular formula C18H39F3O3Si2 and a molecular weight of 416.67 g/mol. Its IUPAC name is (2S,3R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(trifluoromethyl)pentan-1-ol.
| Compound Name | (2S,3R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(trifluoromethyl)pentan-1-ol |
|---|---|
| PubChem CID | 134943548 |
| Molecular Formula | C18H39F3O3Si2 |
| Molecular Weight | 416.67 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (2S,3R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(trifluoromethyl)pentan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO)C(F)(F)F |
| InChI | InChI=1S/C18H39F3O3Si2/c1-16(2,3)25(7,8)23-12-11-15(14(13-22)18(19,20)21)24-26(9,10)17(4,5)6/h14-15,22H,11-13H2,1-10H3/t14-,15+/m0/s1 |
| InChIKey | HFUISAYJZARMQM-LSDHHAIUSA-N |
| XLogP | 5.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|