About (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol
(3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol (PubChem CID 87142131) has the molecular formula C18H42O3Si2
and a molecular weight of 362.70 g/mol. Its IUPAC name is (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol.
Molecular Properties
| Compound Name | (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol |
| PubChem CID | 87142131 |
| Molecular Formula | C18H42O3Si2 |
| Molecular Weight | 362.70 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol |
| SMILES | CC(CO[Si](C)(C)C(C)(C)C)[C@H](CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H42O3Si2/c1-15(14-20-22(8,9)17(2,3)4)16(12-13-19)21-23(10,11)18(5,6)7/h15-16,19H,12-14H2,1-11H3/t15?,16-/m0/s1 |
| InChIKey | MWTJHRSUWJURCQ-LYKKTTPLSA-N |
| XLogP | 5.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.70 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol?
The IUPAC name of (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol (CID 87142131) is (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol.
What is the SMILES notation for (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol?
The canonical SMILES for (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol is CC(CO[Si](C)(C)C(C)(C)C)[C@H](CCO)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol?
The InChIKey is MWTJHRSUWJURCQ-LYKKTTPLSA-N. The full InChI is InChI=1S/C18H42O3Si2/c1-15(14-20-22(8,9)17(2,3)4)16(12-13-19)21-23(10,11)18(5,6)7/h15-16,19H,12-14H2,1-11H3/t15?,16-/m0/s1.
What are the key properties of (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol?
(3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol has a molecular weight of 362.70 g/mol, XLogP of 5.42, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylpentan-1-ol is sourced from PubChem (CID 87142131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).