C17H40O4Si2 — CID 135016182
(2S,4S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentane-2,4-diol (PubChem CID 135016182) has the molecular formula C17H40O4Si2 and a molecular weight of 364.68 g/mol. Its IUPAC name is (2S,4S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentane-2,4-diol.
| Compound Name | (2S,4S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentane-2,4-diol |
|---|---|
| PubChem CID | 135016182 |
| Molecular Formula | C17H40O4Si2 |
| Molecular Weight | 364.68 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | (2S,4S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentane-2,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)C[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H40O4Si2/c1-16(2,3)22(7,8)20-12-14(18)11-15(19)13-21-23(9,10)17(4,5)6/h14-15,18-19H,11-13H2,1-10H3/t14-,15-/m0/s1 |
| InChIKey | IDEIZHRFDBJJME-GJZGRUSLSA-N |
| XLogP | 4.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.68 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|