C18H39F3O4Si2 — CID 139682001
(3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6,6,6-trifluorohexane-1,5-diol (PubChem CID 139682001) has the molecular formula C18H39F3O4Si2 and a molecular weight of 432.67 g/mol. Its IUPAC name is (3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6,6,6-trifluorohexane-1,5-diol.
| Compound Name | (3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6,6,6-trifluorohexane-1,5-diol |
|---|---|
| PubChem CID | 139682001 |
| Molecular Formula | C18H39F3O4Si2 |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6,6,6-trifluorohexane-1,5-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]([C@H](CCO)O[Si](C)(C)C(C)(C)C)[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C18H39F3O4Si2/c1-16(2,3)26(7,8)24-13(11-12-22)14(15(23)18(19,20)21)25-27(9,10)17(4,5)6/h13-15,22-23H,11-12H2,1-10H3/t13-,14+,15+/m0/s1 |
| InChIKey | TVQYJVHWSCLHFX-RRFJBIMHSA-N |
| XLogP | 5.07 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|