C18H42O3Si2 — CID 57230096
(2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexan-1-ol (PubChem CID 57230096) has the molecular formula C18H42O3Si2 and a molecular weight of 362.70 g/mol. Its IUPAC name is (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexan-1-ol.
| Compound Name | (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexan-1-ol |
|---|---|
| PubChem CID | 57230096 |
| Molecular Formula | C18H42O3Si2 |
| Molecular Weight | 362.70 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | (2S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC[C@@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H42O3Si2/c1-17(2,3)22(7,8)20-14-12-11-13-16(15-19)21-23(9,10)18(4,5)6/h16,19H,11-15H2,1-10H3/t16-/m0/s1 |
| InChIKey | WLMNODUIIALDLB-INIZCTEOSA-N |
| XLogP | 5.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.70 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|