C21H29N3O — CID 108849327
(Z)-2-cyano-N-(2,6-diethylphenyl)-3-(2,6-dimethylpiperidin-1-yl)prop-2-enamide (PubChem CID 108849327) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,6-diethylphenyl)-3-(2,6-dimethylpiperidin-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,6-diethylphenyl)-3-(2,6-dimethylpiperidin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108849327 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | (Z)-2-cyano-N-(2,6-diethylphenyl)-3-(2,6-dimethylpiperidin-1-yl)prop-2-enamide |
| SMILES | CCc1cccc(CC)c1NC(=O)/C(C#N)=C\N1C(C)CCCC1C |
| InChI | InChI=1S/C21H29N3O/c1-5-17-11-8-12-18(6-2)20(17)23-21(25)19(13-22)14-24-15(3)9-7-10-16(24)4/h8,11-12,14-16H,5-7,9-10H2,1-4H3,(H,23,25)/b19-14- |
| InChIKey | ZBNYHMNWAQVSTR-RGEXLXHISA-N |
| XLogP | 4.42 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|