C30H52OSi — CID 10884955
tert-butyl-[(2E,7E)-4-tert-butyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,5,7-tetraenoxy]-dimethylsilane (PubChem CID 10884955) has the molecular formula C30H52OSi and a molecular weight of 456.83 g/mol. Its IUPAC name is tert-butyl-[(2E,7E)-4-tert-butyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,5,7-tetraenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,7E)-4-tert-butyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,5,7-tetraenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10884955 |
| Molecular Formula | C30H52OSi |
| Molecular Weight | 456.83 g/mol |
| Exact Mass | 456.38 |
| IUPAC Name | tert-butyl-[(2E,7E)-4-tert-butyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,5,7-tetraenoxy]-dimethylsilane |
| SMILES | CC1=C(C/C=C(\C)C=C=C(/C(C)=C/CO[Si](C)(C)C(C)(C)C)C(C)(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C30H52OSi/c1-23(17-19-27-24(2)15-14-21-30(27,10)11)16-18-26(28(4,5)6)25(3)20-22-31-32(12,13)29(7,8)9/h16-17,20H,14-15,19,21-22H2,1-13H3/b23-17+,25-20+ |
| InChIKey | AVQUEULZOKZHQH-VPAPYFLLSA-N |
| XLogP | 9.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.83 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|