C22H40OSi — CID 11198863
(2,4-dimethyl-4-pent-4-enylcyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane (PubChem CID 11198863) has the molecular formula C22H40OSi and a molecular weight of 348.65 g/mol. Its IUPAC name is (2,4-dimethyl-4-pent-4-enylcyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane.
| Compound Name | (2,4-dimethyl-4-pent-4-enylcyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11198863 |
| Molecular Formula | C22H40OSi |
| Molecular Weight | 348.65 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | (2,4-dimethyl-4-pent-4-enylcyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane |
| SMILES | C=CCCCC1(C)C=CC(O[Si](C(C)C)(C(C)C)C(C)C)=C(C)C1 |
| InChI | InChI=1S/C22H40OSi/c1-10-11-12-14-22(9)15-13-21(20(8)16-22)23-24(17(2)3,18(4)5)19(6)7/h10,13,15,17-19H,1,11-12,14,16H2,2-9H3 |
| InChIKey | ZEWQLEVFKWIYSU-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.65 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|