C19H34OSi — CID 5366890
tert-butyl-dimethyl-[(1E,3E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)buta-1,3-dienoxy]silane (PubChem CID 5366890) has the molecular formula C19H34OSi and a molecular weight of 306.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1E,3E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)buta-1,3-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1E,3E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)buta-1,3-dienoxy]silane |
|---|---|
| PubChem CID | 5366890 |
| Molecular Formula | C19H34OSi |
| Molecular Weight | 306.57 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | tert-butyl-dimethyl-[(1E,3E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)buta-1,3-dienoxy]silane |
| SMILES | CC1=CCCC(C)(C)C1/C=C/C=C/O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34OSi/c1-16-12-11-14-19(5,6)17(16)13-9-10-15-20-21(7,8)18(2,3)4/h9-10,12-13,15,17H,11,14H2,1-8H3/b13-9+,15-10+ |
| InChIKey | HHQIYQODLXVJPD-XHWVFBAXSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.57 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|