C19H34OSi — CID 5366892
tert-butyl-dimethyl-[(Z,3Z)-2-methyl-3-(2,6,6-trimethylcyclohex-2-en-1-ylidene)prop-1-enoxy]silane (PubChem CID 5366892) has the molecular formula C19H34OSi and a molecular weight of 306.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,3Z)-2-methyl-3-(2,6,6-trimethylcyclohex-2-en-1-ylidene)prop-1-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z,3Z)-2-methyl-3-(2,6,6-trimethylcyclohex-2-en-1-ylidene)prop-1-enoxy]silane |
|---|---|
| PubChem CID | 5366892 |
| Molecular Formula | C19H34OSi |
| Molecular Weight | 306.57 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,3Z)-2-methyl-3-(2,6,6-trimethylcyclohex-2-en-1-ylidene)prop-1-enoxy]silane |
| SMILES | CC1=CCCC(C)(C)/C1=C/C(C)=C\O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34OSi/c1-15(14-20-21(8,9)18(3,4)5)13-17-16(2)11-10-12-19(17,6)7/h11,13-14H,10,12H2,1-9H3/b15-14-,17-13+ |
| InChIKey | FDEPTRVZYXFEGY-GFSUVLCASA-N |
| XLogP | 6.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.57 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|