C20H34OSi — CID 138964348
tert-butyl-[1-[(3S,6R)-6-ethenyl-6-methyl-3-prop-1-en-2-ylcyclohexen-1-yl]ethenoxy]-dimethylsilane (PubChem CID 138964348) has the molecular formula C20H34OSi and a molecular weight of 318.58 g/mol. Its IUPAC name is tert-butyl-[1-[(3S,6R)-6-ethenyl-6-methyl-3-prop-1-en-2-ylcyclohexen-1-yl]ethenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-[(3S,6R)-6-ethenyl-6-methyl-3-prop-1-en-2-ylcyclohexen-1-yl]ethenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 138964348 |
| Molecular Formula | C20H34OSi |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | tert-butyl-[1-[(3S,6R)-6-ethenyl-6-methyl-3-prop-1-en-2-ylcyclohexen-1-yl]ethenoxy]-dimethylsilane |
| SMILES | C=C[C@@]1(C)CC[C@H](C(=C)C)C=C1C(=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34OSi/c1-11-20(8)13-12-17(15(2)3)14-18(20)16(4)21-22(9,10)19(5,6)7/h11,14,17H,1-2,4,12-13H2,3,5-10H3/t17-,20-/m0/s1 |
| InChIKey | GUNBKSVEDYUGEA-PXNSSMCTSA-N |
| XLogP | 6.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|