C27H48OSi2 — CID 101201512
[(3R,3aR)-3a-methyl-3-propan-2-yl-5a-triethylsilyloxy-2,3,4,5,6,7-hexahydrobenzo[f]azulen-9-yl]-trimethylsilane (PubChem CID 101201512) has the molecular formula C27H48OSi2 and a molecular weight of 444.85 g/mol. Its IUPAC name is [(3R,3aR)-3a-methyl-3-propan-2-yl-5a-triethylsilyloxy-2,3,4,5,6,7-hexahydrobenzo[f]azulen-9-yl]-trimethylsilane.
| Compound Name | [(3R,3aR)-3a-methyl-3-propan-2-yl-5a-triethylsilyloxy-2,3,4,5,6,7-hexahydrobenzo[f]azulen-9-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101201512 |
| Molecular Formula | C27H48OSi2 |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | [(3R,3aR)-3a-methyl-3-propan-2-yl-5a-triethylsilyloxy-2,3,4,5,6,7-hexahydrobenzo[f]azulen-9-yl]-trimethylsilane |
| SMILES | CC[Si](CC)(CC)OC12CCC=C([Si](C)(C)C)C1=CC1=CC[C@H](C(C)C)[C@@]1(C)CC2 |
| InChI | InChI=1S/C27H48OSi2/c1-10-30(11-2,12-3)28-27-17-13-14-25(29(7,8)9)24(27)20-22-15-16-23(21(4)5)26(22,6)18-19-27/h14-15,20-21,23H,10-13,16-19H2,1-9H3/t23-,26+,27?/m1/s1 |
| InChIKey | GMJJLVDUWCBWGC-KSFIVCTKSA-N |
| XLogP | 8.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|