C25H42OSi — CID 101201511
[(3R,3aR)-3a,9-dimethyl-3-propan-2-yl-2,3,4,5,6,7-hexahydrobenzo[f]azulen-5a-yl]oxy-triethylsilane (PubChem CID 101201511) has the molecular formula C25H42OSi and a molecular weight of 386.70 g/mol. Its IUPAC name is [(3R,3aR)-3a,9-dimethyl-3-propan-2-yl-2,3,4,5,6,7-hexahydrobenzo[f]azulen-5a-yl]oxy-triethylsilane.
| Compound Name | [(3R,3aR)-3a,9-dimethyl-3-propan-2-yl-2,3,4,5,6,7-hexahydrobenzo[f]azulen-5a-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 101201511 |
| Molecular Formula | C25H42OSi |
| Molecular Weight | 386.70 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | [(3R,3aR)-3a,9-dimethyl-3-propan-2-yl-2,3,4,5,6,7-hexahydrobenzo[f]azulen-5a-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC12CCC=C(C)C1=CC1=CC[C@H](C(C)C)[C@@]1(C)CC2 |
| InChI | InChI=1S/C25H42OSi/c1-8-27(9-2,10-3)26-25-15-11-12-20(6)23(25)18-21-13-14-22(19(4)5)24(21,7)16-17-25/h12-13,18-19,22H,8-11,14-17H2,1-7H3/t22-,24+,25?/m1/s1 |
| InChIKey | OKXRARAXNGURDW-JNLGJKASSA-N |
| XLogP | 7.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.70 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|