C23H34OSi — CID 135061333
tert-butyl-dimethyl-[[(13S)-1,2,6,7,11,12,16,17-octahydrocyclopenta[a]phenanthren-13-yl]oxy]silane (PubChem CID 135061333) has the molecular formula C23H34OSi and a molecular weight of 354.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(13S)-1,2,6,7,11,12,16,17-octahydrocyclopenta[a]phenanthren-13-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(13S)-1,2,6,7,11,12,16,17-octahydrocyclopenta[a]phenanthren-13-yl]oxy]silane |
|---|---|
| PubChem CID | 135061333 |
| Molecular Formula | C23H34OSi |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | tert-butyl-dimethyl-[[(13S)-1,2,6,7,11,12,16,17-octahydrocyclopenta[a]phenanthren-13-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]12CCC=C1C1=C(CC2)C2=C(C=CCC2)CC1 |
| InChI | InChI=1S/C23H34OSi/c1-22(2,3)25(4,5)24-23-15-8-11-21(23)20-13-12-17-9-6-7-10-18(17)19(20)14-16-23/h6,9,11H,7-8,10,12-16H2,1-5H3/t23-/m0/s1 |
| InChIKey | QTGRZRFDGKCXGT-QHCPKHFHSA-N |
| XLogP | 7.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|