C19H30OSi — CID 10804358
triethyl(2,3,4,5,8,9-hexahydrocyclopenta[a]naphthalen-3a-yloxy)silane (PubChem CID 10804358) has the molecular formula C19H30OSi and a molecular weight of 302.53 g/mol. Its IUPAC name is triethyl(2,3,4,5,8,9-hexahydrocyclopenta[a]naphthalen-3a-yloxy)silane.
| Compound Name | triethyl(2,3,4,5,8,9-hexahydrocyclopenta[a]naphthalen-3a-yloxy)silane |
|---|---|
| PubChem CID | 10804358 |
| Molecular Formula | C19H30OSi |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | triethyl(2,3,4,5,8,9-hexahydrocyclopenta[a]naphthalen-3a-yloxy)silane |
| SMILES | CC[Si](CC)(CC)OC12CCC=C1C1=C(C=CCC1)CC2 |
| InChI | InChI=1S/C19H30OSi/c1-4-21(5-2,6-3)20-19-14-9-12-18(19)17-11-8-7-10-16(17)13-15-19/h7,10,12H,4-6,8-9,11,13-15H2,1-3H3 |
| InChIKey | XRUBXAQHAGHSOQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|