C11H18OSi — CID 134855646
2,2,8a-trimethyl-7,8-dihydro-3H-1,2-benzoxasiline (PubChem CID 134855646) has the molecular formula C11H18OSi and a molecular weight of 194.35 g/mol. Its IUPAC name is 2,2,8a-trimethyl-7,8-dihydro-3H-1,2-benzoxasiline.
| Compound Name | 2,2,8a-trimethyl-7,8-dihydro-3H-1,2-benzoxasiline |
|---|---|
| PubChem CID | 134855646 |
| Molecular Formula | C11H18OSi |
| Molecular Weight | 194.35 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2,2,8a-trimethyl-7,8-dihydro-3H-1,2-benzoxasiline |
| SMILES | CC12CCC=CC1=CC[Si](C)(C)O2 |
| InChI | InChI=1S/C11H18OSi/c1-11-8-5-4-6-10(11)7-9-13(2,3)12-11/h4,6-7H,5,8-9H2,1-3H3 |
| InChIKey | IBTDPTWUCYSCCY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|