C13H24OSi — CID 70397008
(1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane (PubChem CID 70397008) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane.
| Compound Name | (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 70397008 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane |
| SMILES | CCCCC1(O[Si](C)(C)C)C=CC=CC1 |
| InChI | InChI=1S/C13H24OSi/c1-5-6-10-13(14-15(2,3)4)11-8-7-9-12-13/h7-9,11H,5-6,10,12H2,1-4H3 |
| InChIKey | ZSMWBWBUTYQRQK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|