About (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane
(1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane (PubChem CID 70397008) has the molecular formula C13H24OSi
and a molecular weight of 224.42 g/mol. Its IUPAC name is (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane.
Molecular Properties
| Compound Name | (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane |
| PubChem CID | 70397008 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane |
| SMILES | CCCCC1(O[Si](C)(C)C)C=CC=CC1 |
| InChI | InChI=1S/C13H24OSi/c1-5-6-10-13(14-15(2,3)4)11-8-7-9-12-13/h7-9,11H,5-6,10,12H2,1-4H3 |
| InChIKey | ZSMWBWBUTYQRQK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane?
The IUPAC name of (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane (CID 70397008) is (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane.
What is the SMILES notation for (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane?
The canonical SMILES for (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane is CCCCC1(O[Si](C)(C)C)C=CC=CC1.
What is the InChIKey of (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane?
The InChIKey is ZSMWBWBUTYQRQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24OSi/c1-5-6-10-13(14-15(2,3)4)11-8-7-9-12-13/h7-9,11H,5-6,10,12H2,1-4H3.
What are the key properties of (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane?
(1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane has a molecular weight of 224.42 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-butylcyclohexa-2,4-dien-1-yl)oxy-trimethylsilane is sourced from PubChem (CID 70397008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).