C18H32OSi — CID 11066274
(7,8-dimethyl-3,4,5,6-tetrahydro-2H-naphthalen-4a-yl)oxy-triethylsilane (PubChem CID 11066274) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is (7,8-dimethyl-3,4,5,6-tetrahydro-2H-naphthalen-4a-yl)oxy-triethylsilane.
| Compound Name | (7,8-dimethyl-3,4,5,6-tetrahydro-2H-naphthalen-4a-yl)oxy-triethylsilane |
|---|---|
| PubChem CID | 11066274 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (7,8-dimethyl-3,4,5,6-tetrahydro-2H-naphthalen-4a-yl)oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC12CCCC=C1C(C)=C(C)CC2 |
| InChI | InChI=1S/C18H32OSi/c1-6-20(7-2,8-3)19-18-13-10-9-11-17(18)16(5)15(4)12-14-18/h11H,6-10,12-14H2,1-5H3 |
| InChIKey | QGEZORMRDSOLBL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|