C16H28OSi — CID 11086661
triethyl-[(7-methyl-2,3,4,5-tetrahydroinden-3a-yl)oxy]silane (PubChem CID 11086661) has the molecular formula C16H28OSi and a molecular weight of 264.48 g/mol. Its IUPAC name is triethyl-[(7-methyl-2,3,4,5-tetrahydroinden-3a-yl)oxy]silane.
| Compound Name | triethyl-[(7-methyl-2,3,4,5-tetrahydroinden-3a-yl)oxy]silane |
|---|---|
| PubChem CID | 11086661 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 264.48 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | triethyl-[(7-methyl-2,3,4,5-tetrahydroinden-3a-yl)oxy]silane |
| SMILES | CC[Si](CC)(CC)OC12CCC=C(C)C1=CCC2 |
| InChI | InChI=1S/C16H28OSi/c1-5-18(6-2,7-3)17-16-12-8-10-14(4)15(16)11-9-13-16/h10-11H,5-9,12-13H2,1-4H3 |
| InChIKey | WOCJTAIJKNDEKH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|