C16H28OSi — CID 12723061
trimethyl-[(3E)-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dien-2-yl]oxysilane (PubChem CID 12723061) has the molecular formula C16H28OSi and a molecular weight of 264.49 g/mol. Its IUPAC name is trimethyl-[(3E)-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dien-2-yl]oxysilane.
| Compound Name | trimethyl-[(3E)-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dien-2-yl]oxysilane |
|---|---|
| PubChem CID | 12723061 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 264.49 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | trimethyl-[(3E)-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dien-2-yl]oxysilane |
| SMILES | C=C(/C=C/C1=C(C)CCCC1(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H28OSi/c1-13-9-8-12-16(3,4)15(13)11-10-14(2)17-18(5,6)7/h10-11H,2,8-9,12H2,1,3-7H3/b11-10+ |
| InChIKey | VYFVDHPYMAVRMH-ZHACJKMWSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|