C22H16ClN3O3 — CID 108849656
(Z)-3-(5-chloro-2-hydroxyanilino)-2-cyano-N-(4-phenoxyphenyl)prop-2-enamide (PubChem CID 108849656) has the molecular formula C22H16ClN3O3 and a molecular weight of 405.84 g/mol. Its IUPAC name is (Z)-3-(5-chloro-2-hydroxyanilino)-2-cyano-N-(4-phenoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(5-chloro-2-hydroxyanilino)-2-cyano-N-(4-phenoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108849656 |
| Molecular Formula | C22H16ClN3O3 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (Z)-3-(5-chloro-2-hydroxyanilino)-2-cyano-N-(4-phenoxyphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1cc(Cl)ccc1O)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H16ClN3O3/c23-16-6-11-21(27)20(12-16)25-14-15(13-24)22(28)26-17-7-9-19(10-8-17)29-18-4-2-1-3-5-18/h1-12,14,25,27H,(H,26,28)/b15-14- |
| InChIKey | SUQNPQAVBKYFPI-PFONDFGASA-N |
| XLogP | 5.30 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|