C25H46O6Si — CID 10885188
methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(2S,6R)-2-[(2S,3S)-4-hydroxy-2-methoxy-3-methylbutyl]-3,6-dihydro-2H-pyran-6-yl]-2-methylhex-2-enoate (PubChem CID 10885188) has the molecular formula C25H46O6Si and a molecular weight of 470.72 g/mol. Its IUPAC name is methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(2S,6R)-2-[(2S,3S)-4-hydroxy-2-methoxy-3-methylbutyl]-3,6-dihydro-2H-pyran-6-yl]-2-methylhex-2-enoate.
| Compound Name | methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(2S,6R)-2-[(2S,3S)-4-hydroxy-2-methoxy-3-methylbutyl]-3,6-dihydro-2H-pyran-6-yl]-2-methylhex-2-enoate |
|---|---|
| PubChem CID | 10885188 |
| Molecular Formula | C25H46O6Si |
| Molecular Weight | 470.72 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(2S,6R)-2-[(2S,3S)-4-hydroxy-2-methoxy-3-methylbutyl]-3,6-dihydro-2H-pyran-6-yl]-2-methylhex-2-enoate |
| SMILES | COC(=O)/C(C)=C/C[C@@H](C[C@@H]1C=CC[C@@H](C[C@H](OC)[C@@H](C)CO)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46O6Si/c1-18(24(27)29-7)13-14-22(31-32(8,9)25(3,4)5)15-20-11-10-12-21(30-20)16-23(28-6)19(2)17-26/h10-11,13,19-23,26H,12,14-17H2,1-9H3/b18-13+/t19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | CVQGSQACDGOOOH-YXMGWVHESA-N |
| XLogP | 5.02 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.72 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|