C18H26ClN3O — CID 108854426
(Z)-3-[1-(1-adamantyl)ethylamino]-N-(2-chloroethyl)-2-cyanoprop-2-enamide (PubChem CID 108854426) has the molecular formula C18H26ClN3O and a molecular weight of 335.88 g/mol. Its IUPAC name is (Z)-3-[1-(1-adamantyl)ethylamino]-N-(2-chloroethyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[1-(1-adamantyl)ethylamino]-N-(2-chloroethyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108854426 |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | (Z)-3-[1-(1-adamantyl)ethylamino]-N-(2-chloroethyl)-2-cyanoprop-2-enamide |
| SMILES | CC(N/C=C(/C#N)C(=O)NCCCl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H26ClN3O/c1-12(22-11-16(10-20)17(23)21-3-2-19)18-7-13-4-14(8-18)6-15(5-13)9-18/h11-15,22H,2-9H2,1H3,(H,21,23)/b16-11- |
| InChIKey | WTHAIHGTBRPEBG-WJDWOHSUSA-N |
| XLogP | 2.94 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|