C19H24N4O4 — CID 108856959
tert-butyl N-[(Z)-3-(3-acetylanilino)-2-cyano-3-oxoprop-1-enyl]-N-(2-aminoethyl)carbamate (PubChem CID 108856959) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is tert-butyl N-[(Z)-3-(3-acetylanilino)-2-cyano-3-oxoprop-1-enyl]-N-(2-aminoethyl)carbamate.
| Compound Name | tert-butyl N-[(Z)-3-(3-acetylanilino)-2-cyano-3-oxoprop-1-enyl]-N-(2-aminoethyl)carbamate |
|---|---|
| PubChem CID | 108856959 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | tert-butyl N-[(Z)-3-(3-acetylanilino)-2-cyano-3-oxoprop-1-enyl]-N-(2-aminoethyl)carbamate |
| SMILES | CC(=O)c1cccc(NC(=O)/C(C#N)=C\N(CCN)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C19H24N4O4/c1-13(24)14-6-5-7-16(10-14)22-17(25)15(11-21)12-23(9-8-20)18(26)27-19(2,3)4/h5-7,10,12H,8-9,20H2,1-4H3,(H,22,25)/b15-12- |
| InChIKey | SZIARUSIDJTSBF-QINSGFPZSA-N |
| XLogP | 2.43 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|