C24H32INO7 — CID 10886316
methyl (3aR,4R,5S,5aS,8aR,8bR)-7-hydroxy-4-iodo-5-[4-[(4-methoxyphenyl)methoxy]butyl]-2-oxo-3a,4,5,5a,7,8,8a,8b-octahydro-1H-furo[3,2-e]indole-6-carboxylate (PubChem CID 10886316) has the molecular formula C24H32INO7 and a molecular weight of 573.42 g/mol. Its IUPAC name is methyl (3aR,4R,5S,5aS,8aR,8bR)-7-hydroxy-4-iodo-5-[4-[(4-methoxyphenyl)methoxy]butyl]-2-oxo-3a,4,5,5a,7,8,8a,8b-octahydro-1H-furo[3,2-e]indole-6-carboxylate.
| Compound Name | methyl (3aR,4R,5S,5aS,8aR,8bR)-7-hydroxy-4-iodo-5-[4-[(4-methoxyphenyl)methoxy]butyl]-2-oxo-3a,4,5,5a,7,8,8a,8b-octahydro-1H-furo[3,2-e]indole-6-carboxylate |
|---|---|
| PubChem CID | 10886316 |
| Molecular Formula | C24H32INO7 |
| Molecular Weight | 573.42 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | methyl (3aR,4R,5S,5aS,8aR,8bR)-7-hydroxy-4-iodo-5-[4-[(4-methoxyphenyl)methoxy]butyl]-2-oxo-3a,4,5,5a,7,8,8a,8b-octahydro-1H-furo[3,2-e]indole-6-carboxylate |
| SMILES | COC(=O)N1C(O)C[C@@H]2[C@H]3CC(=O)O[C@H]3[C@H](I)[C@@H](CCCCOCc3ccc(OC)cc3)[C@H]21 |
| InChI | InChI=1S/C24H32INO7/c1-30-15-8-6-14(7-9-15)13-32-10-4-3-5-16-21(25)23-18(12-20(28)33-23)17-11-19(27)26(22(16)17)24(29)31-2/h6-9,16-19,21-23,27H,3-5,10-13H2,1-2H3/t16-,17-,18-,19?,21-,22-,23-/m1/s1 |
| InChIKey | KNYPMNNDQXHXSE-PLPWEANPSA-N |
| XLogP | 3.52 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|