C29H41NO7 — CID 11071334
methyl (1S,3aS,4R,5R,5aR,8aR,8bS)-7-methoxy-5-[4-[(4-methoxyphenyl)methoxy]butyl]-1-methyl-2-oxo-4-prop-2-enyl-3a,4,5,5a,7,8,8a,8b-octahydro-1H-furo[3,2-e]indole-6-carboxylate (PubChem CID 11071334) has the molecular formula C29H41NO7 and a molecular weight of 515.65 g/mol. Its IUPAC name is methyl (1S,3aS,4R,5R,5aR,8aR,8bS)-7-methoxy-5-[4-[(4-methoxyphenyl)methoxy]butyl]-1-methyl-2-oxo-4-prop-2-enyl-3a,4,5,5a,7,8,8a,8b-octahydro-1H-furo[3,2-e]indole-6-carboxylate.
| Compound Name | methyl (1S,3aS,4R,5R,5aR,8aR,8bS)-7-methoxy-5-[4-[(4-methoxyphenyl)methoxy]butyl]-1-methyl-2-oxo-4-prop-2-enyl-3a,4,5,5a,7,8,8a,8b-octahydro-1H-furo[3,2-e]indole-6-carboxylate |
|---|---|
| PubChem CID | 11071334 |
| Molecular Formula | C29H41NO7 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | methyl (1S,3aS,4R,5R,5aR,8aR,8bS)-7-methoxy-5-[4-[(4-methoxyphenyl)methoxy]butyl]-1-methyl-2-oxo-4-prop-2-enyl-3a,4,5,5a,7,8,8a,8b-octahydro-1H-furo[3,2-e]indole-6-carboxylate |
| SMILES | C=CC[C@@H]1[C@@H](CCCCOCc2ccc(OC)cc2)[C@@H]2[C@H](CC(OC)N2C(=O)OC)[C@@H]2[C@H]1OC(=O)[C@H]2C |
| InChI | InChI=1S/C29H41NO7/c1-6-9-22-21(10-7-8-15-36-17-19-11-13-20(33-3)14-12-19)26-23(25-18(2)28(31)37-27(22)25)16-24(34-4)30(26)29(32)35-5/h6,11-14,18,21-27H,1,7-10,15-17H2,2-5H3/t18-,21+,22+,23+,24?,25+,26+,27-/m0/s1 |
| InChIKey | OISHYIIFMRTROJ-ZNYTZJLDSA-N |
| XLogP | 4.81 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|