C37H53NO4 — CID 139192238
(2S,3S,8R,8aR)-8-[(4-methoxyphenyl)methoxy]-3-(2-methylprop-2-enyl)-2-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 139192238) has the molecular formula C37H53NO4 and a molecular weight of 575.83 g/mol. Its IUPAC name is (2S,3S,8R,8aR)-8-[(4-methoxyphenyl)methoxy]-3-(2-methylprop-2-enyl)-2-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (2S,3S,8R,8aR)-8-[(4-methoxyphenyl)methoxy]-3-(2-methylprop-2-enyl)-2-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 139192238 |
| Molecular Formula | C37H53NO4 |
| Molecular Weight | 575.83 g/mol |
| Exact Mass | 575.40 |
| IUPAC Name | (2S,3S,8R,8aR)-8-[(4-methoxyphenyl)methoxy]-3-(2-methylprop-2-enyl)-2-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | C=C(C)C[C@H]1[C@@H](O[C@H](C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)C[C@@H]2[C@H](OCc3ccc(OC)cc3)CCC(=O)N21 |
| InChI | InChI=1S/C37H53NO4/c1-22(2)17-32-35(42-26(9)37-30(24(5)6)18-28(23(3)4)19-31(37)25(7)8)20-33-34(15-16-36(39)38(32)33)41-21-27-11-13-29(40-10)14-12-27/h11-14,18-19,23-26,32-35H,1,15-17,20-21H2,2-10H3/t26-,32+,33-,34-,35+/m1/s1 |
| InChIKey | WBYHIIKZXBHCCR-TXKPASSSSA-N |
| XLogP | 8.83 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.83 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|