C34H53NO5Si — CID 10940892
benzyl (3aS,4R,5R,5aR,8aR,8bR)-2-oxo-4-prop-2-enyl-5-[4-tri(propan-2-yl)silyloxybutyl]-3a,4,5,5a,7,8,8a,8b-octahydro-1H-furo[3,2-e]indole-6-carboxylate (PubChem CID 10940892) has the molecular formula C34H53NO5Si and a molecular weight of 583.89 g/mol. Its IUPAC name is benzyl (3aS,4R,5R,5aR,8aR,8bR)-2-oxo-4-prop-2-enyl-5-[4-tri(propan-2-yl)silyloxybutyl]-3a,4,5,5a,7,8,8a,8b-octahydro-1H-furo[3,2-e]indole-6-carboxylate.
| Compound Name | benzyl (3aS,4R,5R,5aR,8aR,8bR)-2-oxo-4-prop-2-enyl-5-[4-tri(propan-2-yl)silyloxybutyl]-3a,4,5,5a,7,8,8a,8b-octahydro-1H-furo[3,2-e]indole-6-carboxylate |
|---|---|
| PubChem CID | 10940892 |
| Molecular Formula | C34H53NO5Si |
| Molecular Weight | 583.89 g/mol |
| Exact Mass | 583.37 |
| IUPAC Name | benzyl (3aS,4R,5R,5aR,8aR,8bR)-2-oxo-4-prop-2-enyl-5-[4-tri(propan-2-yl)silyloxybutyl]-3a,4,5,5a,7,8,8a,8b-octahydro-1H-furo[3,2-e]indole-6-carboxylate |
| SMILES | C=CC[C@@H]1[C@@H](CCCCO[Si](C(C)C)(C(C)C)C(C)C)[C@@H]2[C@H](CCN2C(=O)OCc2ccccc2)[C@H]2CC(=O)O[C@@H]12 |
| InChI | InChI=1S/C34H53NO5Si/c1-8-14-29-27(17-12-13-20-39-41(23(2)3,24(4)5)25(6)7)32-28(30-21-31(36)40-33(29)30)18-19-35(32)34(37)38-22-26-15-10-9-11-16-26/h8-11,15-16,23-25,27-30,32-33H,1,12-14,17-22H2,2-7H3/t27-,28-,29-,30-,32-,33+/m1/s1 |
| InChIKey | JQFBDESLGVMISH-ZYVOKMQKSA-N |
| XLogP | 8.13 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.89 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|