C37H63NO5Si — CID 122387389
tert-butyl (2S,5S,6S)-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxynonyl]-7-oxo-2-(phenylmethoxymethyl)-1-azaspiro[4.5]decane-1-carboxylate (PubChem CID 122387389) has the molecular formula C37H63NO5Si and a molecular weight of 630.00 g/mol. Its IUPAC name is tert-butyl (2S,5S,6S)-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxynonyl]-7-oxo-2-(phenylmethoxymethyl)-1-azaspiro[4.5]decane-1-carboxylate.
| Compound Name | tert-butyl (2S,5S,6S)-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxynonyl]-7-oxo-2-(phenylmethoxymethyl)-1-azaspiro[4.5]decane-1-carboxylate |
|---|---|
| PubChem CID | 122387389 |
| Molecular Formula | C37H63NO5Si |
| Molecular Weight | 630.00 g/mol |
| Exact Mass | 629.45 |
| IUPAC Name | tert-butyl (2S,5S,6S)-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxynonyl]-7-oxo-2-(phenylmethoxymethyl)-1-azaspiro[4.5]decane-1-carboxylate |
| SMILES | CCCCCC[C@@H](CC[C@@H]1C(=O)CCC[C@]12CC[C@@H](COCc1ccccc1)N2C(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H63NO5Si/c1-10-11-12-16-20-31(43-44(8,9)36(5,6)7)22-23-32-33(39)21-17-25-37(32)26-24-30(38(37)34(40)42-35(2,3)4)28-41-27-29-18-14-13-15-19-29/h13-15,18-19,30-32H,10-12,16-17,20-28H2,1-9H3/t30-,31-,32+,37-/m0/s1 |
| InChIKey | AOMZZNWWQKQAID-MHFPBVHJSA-N |
| XLogP | 9.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.00 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|