C19H23NO4 — CID 102174899
benzyl (3aR,5S,7aS)-2-oxospiro[3,3a,4,6,7,7a-hexahydro-1-benzofuran-5,2'-pyrrolidine]-1'-carboxylate (PubChem CID 102174899) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is benzyl (3aR,5S,7aS)-2-oxospiro[3,3a,4,6,7,7a-hexahydro-1-benzofuran-5,2'-pyrrolidine]-1'-carboxylate.
| Compound Name | benzyl (3aR,5S,7aS)-2-oxospiro[3,3a,4,6,7,7a-hexahydro-1-benzofuran-5,2'-pyrrolidine]-1'-carboxylate |
|---|---|
| PubChem CID | 102174899 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | benzyl (3aR,5S,7aS)-2-oxospiro[3,3a,4,6,7,7a-hexahydro-1-benzofuran-5,2'-pyrrolidine]-1'-carboxylate |
| SMILES | O=C1C[C@H]2C[C@]3(CCCN3C(=O)OCc3ccccc3)CC[C@@H]2O1 |
| InChI | InChI=1S/C19H23NO4/c21-17-11-15-12-19(9-7-16(15)24-17)8-4-10-20(19)18(22)23-13-14-5-2-1-3-6-14/h1-3,5-6,15-16H,4,7-13H2/t15-,16-,19-/m0/s1 |
| InChIKey | QMGIBFMCCGVMOH-BXWFABGCSA-N |
| XLogP | 3.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |