C24H33NO7Si — CID 10648233
7-O-benzyl 8-O-methyl (3aR,4R,5S,6aR,8S,9aR)-5-methyl-2-oxo-4-trimethylsilyloxy-3,3a,4,5,6,6a,8,9-octahydrofuro[2,3-d]indole-7,8-dicarboxylate (PubChem CID 10648233) has the molecular formula C24H33NO7Si and a molecular weight of 475.61 g/mol. Its IUPAC name is 7-O-benzyl 8-O-methyl (3aR,4R,5S,6aR,8S,9aR)-5-methyl-2-oxo-4-trimethylsilyloxy-3,3a,4,5,6,6a,8,9-octahydrofuro[2,3-d]indole-7,8-dicarboxylate.
| Compound Name | 7-O-benzyl 8-O-methyl (3aR,4R,5S,6aR,8S,9aR)-5-methyl-2-oxo-4-trimethylsilyloxy-3,3a,4,5,6,6a,8,9-octahydrofuro[2,3-d]indole-7,8-dicarboxylate |
|---|---|
| PubChem CID | 10648233 |
| Molecular Formula | C24H33NO7Si |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 7-O-benzyl 8-O-methyl (3aR,4R,5S,6aR,8S,9aR)-5-methyl-2-oxo-4-trimethylsilyloxy-3,3a,4,5,6,6a,8,9-octahydrofuro[2,3-d]indole-7,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]23OC(=O)C[C@@H]2[C@H](O[Si](C)(C)C)[C@@H](C)C[C@H]3N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H33NO7Si/c1-15-11-19-24(17(12-20(26)31-24)21(15)32-33(3,4)5)13-18(22(27)29-2)25(19)23(28)30-14-16-9-7-6-8-10-16/h6-10,15,17-19,21H,11-14H2,1-5H3/t15-,17+,18-,19+,21+,24+/m0/s1 |
| InChIKey | QDHZXKPASXMYEH-UOHNPMNASA-N |
| XLogP | 3.50 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|