C20H25NO7 — CID 5461368
3-O-benzyl 4-O-methyl (1aR,2aR,4S,5aR,6R,6aS)-5a-hydroxy-6-(2-hydroxyethyl)-2,2a,4,5,6,6a-hexahydro-1aH-oxireno[2,3-f]indole-3,4-dicarboxylate (PubChem CID 5461368) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is 3-O-benzyl 4-O-methyl (1aR,2aR,4S,5aR,6R,6aS)-5a-hydroxy-6-(2-hydroxyethyl)-2,2a,4,5,6,6a-hexahydro-1aH-oxireno[2,3-f]indole-3,4-dicarboxylate.
| Compound Name | 3-O-benzyl 4-O-methyl (1aR,2aR,4S,5aR,6R,6aS)-5a-hydroxy-6-(2-hydroxyethyl)-2,2a,4,5,6,6a-hexahydro-1aH-oxireno[2,3-f]indole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 5461368 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 3-O-benzyl 4-O-methyl (1aR,2aR,4S,5aR,6R,6aS)-5a-hydroxy-6-(2-hydroxyethyl)-2,2a,4,5,6,6a-hexahydro-1aH-oxireno[2,3-f]indole-3,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]2(O)[C@H](CCO)[C@@H]3O[C@@H]3C[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H25NO7/c1-26-18(23)14-10-20(25)13(7-8-22)17-15(28-17)9-16(20)21(14)19(24)27-11-12-5-3-2-4-6-12/h2-6,13-17,22,25H,7-11H2,1H3/t13-,14+,15-,16-,17+,20-/m1/s1 |
| InChIKey | YNFBFHVBBSALAH-FPEUBTHASA-N |
| XLogP | 0.84 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|