C18H23N3O2 — CID 108863547
(Z)-3-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 108863547) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is (Z)-3-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-3-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108863547 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (Z)-3-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | CC(N/C=C(/C#N)C(=O)NCc1ccco1)C1CC2CCC1C2 |
| InChI | InChI=1S/C18H23N3O2/c1-12(17-8-13-4-5-14(17)7-13)20-10-15(9-19)18(22)21-11-16-3-2-6-23-16/h2-3,6,10,12-14,17,20H,4-5,7-8,11H2,1H3,(H,21,22)/b15-10- |
| InChIKey | JLWNQNPNXKEVFT-GDNBJRDFSA-N |
| XLogP | 2.72 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|