C16H21N3O2 — CID 108863394
(Z)-2-cyano-3-(3,5-dimethylpiperidin-1-yl)-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 108863394) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,5-dimethylpiperidin-1-yl)-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,5-dimethylpiperidin-1-yl)-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108863394 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (Z)-2-cyano-3-(3,5-dimethylpiperidin-1-yl)-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | CC1CC(C)CN(/C=C(/C#N)C(=O)NCc2ccco2)C1 |
| InChI | InChI=1S/C16H21N3O2/c1-12-6-13(2)10-19(9-12)11-14(7-17)16(20)18-8-15-4-3-5-21-15/h3-5,11-13H,6,8-10H2,1-2H3,(H,18,20)/b14-11- |
| InChIKey | WSAIKEJBMCAWJZ-KAMYIIQDSA-N |
| XLogP | 2.28 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|