C21H23N4O2+ — CID 7693578
(E)-2-cyano-N-(furan-2-ylmethyl)-3-[4-[(E)-2-phenylethenyl]piperazin-4-ium-1-yl]prop-2-enamide (PubChem CID 7693578) has the molecular formula C21H23N4O2+ and a molecular weight of 363.44 g/mol. Its IUPAC name is (E)-2-cyano-N-(furan-2-ylmethyl)-3-[4-[(E)-2-phenylethenyl]piperazin-4-ium-1-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(furan-2-ylmethyl)-3-[4-[(E)-2-phenylethenyl]piperazin-4-ium-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 7693578 |
| Molecular Formula | C21H23N4O2+ |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (E)-2-cyano-N-(furan-2-ylmethyl)-3-[4-[(E)-2-phenylethenyl]piperazin-4-ium-1-yl]prop-2-enamide |
| SMILES | N#C/C(=C\N1CC[NH+](/C=C/c2ccccc2)CC1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C21H22N4O2/c22-15-19(21(26)23-16-20-7-4-14-27-20)17-25-12-10-24(11-13-25)9-8-18-5-2-1-3-6-18/h1-9,14,17H,10-13,16H2,(H,23,26)/p+1/b9-8+,19-17+ |
| InChIKey | GHGLXGCTFYIRHR-JUMSSORRSA-O |
| XLogP | 1.17 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|