C31H61BrO2Si2 — CID 10886548
[(3S,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-[tert-butyl(dimethyl)silyl]oxy-2-methylheptan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10886548) has the molecular formula C31H61BrO2Si2 and a molecular weight of 601.90 g/mol. Its IUPAC name is [(3S,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-[tert-butyl(dimethyl)silyl]oxy-2-methylheptan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-[tert-butyl(dimethyl)silyl]oxy-2-methylheptan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10886548 |
| Molecular Formula | C31H61BrO2Si2 |
| Molecular Weight | 601.90 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | [(3S,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-[tert-butyl(dimethyl)silyl]oxy-2-methylheptan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H](CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2/C(=C/Br)CCC[C@]12C |
| InChI | InChI=1S/C31H61BrO2Si2/c1-23(25-18-19-26-24(22-32)16-15-21-31(25,26)10)17-20-27(33-35(11,12)28(2,3)4)30(8,9)34-36(13,14)29(5,6)7/h22-23,25-27H,15-21H2,1-14H3/b24-22+/t23-,25-,26+,27+,31-/m1/s1 |
| InChIKey | DJCGNIUQJGEPND-KMLRARFPSA-N |
| XLogP | 11.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.90 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|