C13H22N2O2 — CID 108868503
1-(furan-2-yl)-3-(2,4,4-trimethylpentan-2-yl)urea (PubChem CID 108868503) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-(furan-2-yl)-3-(2,4,4-trimethylpentan-2-yl)urea.
| Compound Name | 1-(furan-2-yl)-3-(2,4,4-trimethylpentan-2-yl)urea |
|---|---|
| PubChem CID | 108868503 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-(furan-2-yl)-3-(2,4,4-trimethylpentan-2-yl)urea |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)Nc1ccco1 |
| InChI | InChI=1S/C13H22N2O2/c1-12(2,3)9-13(4,5)15-11(16)14-10-7-6-8-17-10/h6-8H,9H2,1-5H3,(H2,14,15,16) |
| InChIKey | GLOQGYNLEGBOAX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |