C41H42O7S — CID 10886934
(3R,4S,5R,6R)-2-benzylsulfonyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 10886934) has the molecular formula C41H42O7S and a molecular weight of 678.85 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-benzylsulfonyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (3R,4S,5R,6R)-2-benzylsulfonyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 10886934 |
| Molecular Formula | C41H42O7S |
| Molecular Weight | 678.85 g/mol |
| Exact Mass | 678.27 |
| IUPAC Name | (3R,4S,5R,6R)-2-benzylsulfonyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | O=S(=O)(Cc1ccccc1)C1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H42O7S/c42-49(43,31-36-24-14-5-15-25-36)41-40(47-29-35-22-12-4-13-23-35)39(46-28-34-20-10-3-11-21-34)38(45-27-33-18-8-2-9-19-33)37(48-41)30-44-26-32-16-6-1-7-17-32/h1-25,37-41H,26-31H2/t37-,38-,39+,40-,41?/m1/s1 |
| InChIKey | RVWRBAMWLVDHHG-WWGFXPMHSA-N |
| XLogP | 7.30 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.85 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |