C26H31NO5 — CID 1088694
4-ethoxy-3-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)benzoic acid (PubChem CID 1088694) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 4-ethoxy-3-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)benzoic acid.
| Compound Name | 4-ethoxy-3-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)benzoic acid |
|---|---|
| PubChem CID | 1088694 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 4-ethoxy-3-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)benzoic acid |
| SMILES | CCOc1ccc(C(=O)O)cc1C1C2=C(CC(C)(C)CC2=O)NC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C26H31NO5/c1-6-32-20-8-7-14(24(30)31)9-15(20)21-22-16(10-25(2,3)12-18(22)28)27-17-11-26(4,5)13-19(29)23(17)21/h7-9,21,27H,6,10-13H2,1-5H3,(H,30,31) |
| InChIKey | LFVMQSJCGUEHIY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |