C17H16ClN3O4 — CID 108874513
1-(4-chloro-3-nitrophenyl)-3-[3-(4-methylphenyl)-3-oxopropyl]urea (PubChem CID 108874513) has the molecular formula C17H16ClN3O4 and a molecular weight of 361.79 g/mol. Its IUPAC name is 1-(4-chloro-3-nitrophenyl)-3-[3-(4-methylphenyl)-3-oxopropyl]urea.
| Compound Name | 1-(4-chloro-3-nitrophenyl)-3-[3-(4-methylphenyl)-3-oxopropyl]urea |
|---|---|
| PubChem CID | 108874513 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)-3-[3-(4-methylphenyl)-3-oxopropyl]urea |
| SMILES | Cc1ccc(C(=O)CCNC(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H16ClN3O4/c1-11-2-4-12(5-3-11)16(22)8-9-19-17(23)20-13-6-7-14(18)15(10-13)21(24)25/h2-7,10H,8-9H2,1H3,(H2,19,20,23) |
| InChIKey | YRFPQHINIXRTOB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|