C16H27N3O3 — CID 108877258
1-[2-(diethylamino)ethyl]-3-[(2-ethoxyphenoxy)methyl]urea (PubChem CID 108877258) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-[(2-ethoxyphenoxy)methyl]urea.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-[(2-ethoxyphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108877258 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-[(2-ethoxyphenoxy)methyl]urea |
| SMILES | CCOc1ccccc1OCNC(=O)NCCN(CC)CC |
| InChI | InChI=1S/C16H27N3O3/c1-4-19(5-2)12-11-17-16(20)18-13-22-15-10-8-7-9-14(15)21-6-3/h7-10H,4-6,11-13H2,1-3H3,(H2,17,18,20) |
| InChIKey | JIWDDWTZSOBZOS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|