C26H35N3O4 — CID 108882957
4-(1,3-benzodioxol-5-ylmethyl)-N-[3-(4-tert-butylphenoxy)propyl]piperazine-1-carboxamide (PubChem CID 108882957) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-N-[3-(4-tert-butylphenoxy)propyl]piperazine-1-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[3-(4-tert-butylphenoxy)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108882957 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[3-(4-tert-butylphenoxy)propyl]piperazine-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(OCCCNC(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C26H35N3O4/c1-26(2,3)21-6-8-22(9-7-21)31-16-4-11-27-25(30)29-14-12-28(13-15-29)18-20-5-10-23-24(17-20)33-19-32-23/h5-10,17H,4,11-16,18-19H2,1-3H3,(H,27,30) |
| InChIKey | IIOXNEPFTMPOOY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|