C18H25ClN2O4 — CID 108883477
ethyl 1-[3-(2-chlorophenoxy)propylcarbamoyl]piperidine-3-carboxylate (PubChem CID 108883477) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is ethyl 1-[3-(2-chlorophenoxy)propylcarbamoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[3-(2-chlorophenoxy)propylcarbamoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 108883477 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | ethyl 1-[3-(2-chlorophenoxy)propylcarbamoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)NCCCOc2ccccc2Cl)C1 |
| InChI | InChI=1S/C18H25ClN2O4/c1-2-24-17(22)14-7-5-11-21(13-14)18(23)20-10-6-12-25-16-9-4-3-8-15(16)19/h3-4,8-9,14H,2,5-7,10-13H2,1H3,(H,20,23) |
| InChIKey | WPIXTBWDRLZPNK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|