C10H15NO2 — CID 10888545
tert-butyl (1S,4S)-2-azabicyclo[2.2.0]hex-5-ene-2-carboxylate (PubChem CID 10888545) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is tert-butyl (1S,4S)-2-azabicyclo[2.2.0]hex-5-ene-2-carboxylate.
| Compound Name | tert-butyl (1S,4S)-2-azabicyclo[2.2.0]hex-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 10888545 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | tert-butyl (1S,4S)-2-azabicyclo[2.2.0]hex-5-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C=C[C@@H]21 |
| InChI | InChI=1S/C10H15NO2/c1-10(2,3)13-9(12)11-6-7-4-5-8(7)11/h4-5,7-8H,6H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | YKVCYDCPZFUYDY-YUMQZZPRSA-N |
| XLogP | 1.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|