C12H25NO — CID 10888913
(5R,6R)-9-amino-6-ethyl-2-methylnon-1-en-5-ol (PubChem CID 10888913) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is (5R,6R)-9-amino-6-ethyl-2-methylnon-1-en-5-ol.
| Compound Name | (5R,6R)-9-amino-6-ethyl-2-methylnon-1-en-5-ol |
|---|---|
| PubChem CID | 10888913 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (5R,6R)-9-amino-6-ethyl-2-methylnon-1-en-5-ol |
| SMILES | C=C(C)CC[C@@H](O)C(CC)CCCN |
| InChI | InChI=1S/C12H25NO/c1-4-11(6-5-9-13)12(14)8-7-10(2)3/h11-12,14H,2,4-9,13H2,1,3H3/t11?,12-/m1/s1 |
| InChIKey | GKVHSJNHPJPZTO-PIJUOVFKSA-N |
| XLogP | 2.47 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|