C14H16F3N3O2 — CID 108892423
1-[3-(2-oxopyrrolidin-1-yl)propyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 108892423) has the molecular formula C14H16F3N3O2 and a molecular weight of 315.29 g/mol. Its IUPAC name is 1-[3-(2-oxopyrrolidin-1-yl)propyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[3-(2-oxopyrrolidin-1-yl)propyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 108892423 |
| Molecular Formula | C14H16F3N3O2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-[3-(2-oxopyrrolidin-1-yl)propyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(NCCCN1CCCC1=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H16F3N3O2/c15-9-4-5-10(13(17)12(9)16)19-14(22)18-6-2-8-20-7-1-3-11(20)21/h4-5H,1-3,6-8H2,(H2,18,19,22) |
| InChIKey | HJHXSCJSRNBQFW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|