C15H27N — CID 10889473
(5S)-pentadeca-1,8,9-trien-5-amine (PubChem CID 10889473) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (5S)-pentadeca-1,8,9-trien-5-amine.
| Compound Name | (5S)-pentadeca-1,8,9-trien-5-amine |
|---|---|
| PubChem CID | 10889473 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (5S)-pentadeca-1,8,9-trien-5-amine |
| SMILES | C=CCC[C@H](N)CCC=C=CCCCCC |
| InChI | InChI=1S/C15H27N/c1-3-5-7-8-9-10-11-12-14-15(16)13-6-4-2/h4,9,11,15H,2-3,5-8,12-14,16H2,1H3/t10?,15-/m0/s1 |
| InChIKey | AEGCZQKPSBMKEK-WRXSAAJRSA-N |
| XLogP | 4.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|