C9H11F3O3 — CID 10889535
1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,2-trifluoroethanone (PubChem CID 10889535) has the molecular formula C9H11F3O3 and a molecular weight of 224.18 g/mol. Its IUPAC name is 1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 10889535 |
| Molecular Formula | C9H11F3O3 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,2-trifluoroethanone |
| SMILES | C=C[C@H]1OC(C)(C)O[C@H]1C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O3/c1-4-5-6(7(13)9(10,11)12)15-8(2,3)14-5/h4-6H,1H2,2-3H3/t5-,6-/m1/s1 |
| InChIKey | WMDUYNMMOLVDSO-PHDIDXHHSA-N |
| XLogP | 1.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|